C14H13BrClNO3 — CID 86014560
butyl 1-bromo-7-chloro-4-hydroxyisoquinoline-3-carboxylate (PubChem CID 86014560) has the molecular formula C14H13BrClNO3 and a molecular weight of 358.62 g/mol. Its IUPAC name is butyl 1-bromo-7-chloro-4-hydroxyisoquinoline-3-carboxylate.
| Compound Name | butyl 1-bromo-7-chloro-4-hydroxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 86014560 |
| Molecular Formula | C14H13BrClNO3 |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | butyl 1-bromo-7-chloro-4-hydroxyisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1nc(Br)c2cc(Cl)ccc2c1O |
| InChI | InChI=1S/C14H13BrClNO3/c1-2-3-6-20-14(19)11-12(18)9-5-4-8(16)7-10(9)13(15)17-11/h4-5,7,18H,2-3,6H2,1H3 |
| InChIKey | ASBHHVCORSLORK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|