C14H17NO3S — CID 67234395
butyl 4-hydroxy-2,7-dimethylthieno[2,3-c]pyridine-5-carboxylate (PubChem CID 67234395) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is butyl 4-hydroxy-2,7-dimethylthieno[2,3-c]pyridine-5-carboxylate.
| Compound Name | butyl 4-hydroxy-2,7-dimethylthieno[2,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 67234395 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | butyl 4-hydroxy-2,7-dimethylthieno[2,3-c]pyridine-5-carboxylate |
| SMILES | CCCCOC(=O)c1nc(C)c2sc(C)cc2c1O |
| InChI | InChI=1S/C14H17NO3S/c1-4-5-6-18-14(17)11-12(16)10-7-8(2)19-13(10)9(3)15-11/h7,16H,4-6H2,1-3H3 |
| InChIKey | UYQMVZGLYRZNMT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|