C12H12ClNO3S — CID 87318571
butyl 4-chloro-7-hydroxythieno[3,2-c]pyridine-6-carboxylate (PubChem CID 87318571) has the molecular formula C12H12ClNO3S and a molecular weight of 285.75 g/mol. Its IUPAC name is butyl 4-chloro-7-hydroxythieno[3,2-c]pyridine-6-carboxylate.
| Compound Name | butyl 4-chloro-7-hydroxythieno[3,2-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 87318571 |
| Molecular Formula | C12H12ClNO3S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | butyl 4-chloro-7-hydroxythieno[3,2-c]pyridine-6-carboxylate |
| SMILES | CCCCOC(=O)c1nc(Cl)c2ccsc2c1O |
| InChI | InChI=1S/C12H12ClNO3S/c1-2-3-5-17-12(16)8-9(15)10-7(4-6-18-10)11(13)14-8/h4,6,15H,2-3,5H2,1H3 |
| InChIKey | KENYXLNSZRNHIT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|