C17H20ClNO4 — CID 174422912
butyl 1-chloro-4-hydroxy-7-propoxyisoquinoline-3-carboxylate (PubChem CID 174422912) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is butyl 1-chloro-4-hydroxy-7-propoxyisoquinoline-3-carboxylate.
| Compound Name | butyl 1-chloro-4-hydroxy-7-propoxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 174422912 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | butyl 1-chloro-4-hydroxy-7-propoxyisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1nc(Cl)c2cc(OCCC)ccc2c1O |
| InChI | InChI=1S/C17H20ClNO4/c1-3-5-9-23-17(21)14-15(20)12-7-6-11(22-8-4-2)10-13(12)16(18)19-14/h6-7,10,20H,3-5,8-9H2,1-2H3 |
| InChIKey | TUHRCKNHGSRMBU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|