C16H15NO3S2 — CID 67233627
butyl 7-hydroxy-4-thiophen-2-ylthieno[3,2-c]pyridine-6-carboxylate (PubChem CID 67233627) has the molecular formula C16H15NO3S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is butyl 7-hydroxy-4-thiophen-2-ylthieno[3,2-c]pyridine-6-carboxylate.
| Compound Name | butyl 7-hydroxy-4-thiophen-2-ylthieno[3,2-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 67233627 |
| Molecular Formula | C16H15NO3S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | butyl 7-hydroxy-4-thiophen-2-ylthieno[3,2-c]pyridine-6-carboxylate |
| SMILES | CCCCOC(=O)c1nc(-c2cccs2)c2ccsc2c1O |
| InChI | InChI=1S/C16H15NO3S2/c1-2-3-7-20-16(19)13-14(18)15-10(6-9-22-15)12(17-13)11-5-4-8-21-11/h4-6,8-9,18H,2-3,7H2,1H3 |
| InChIKey | DTBWSBMLXYNREI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|