C16H15NO2S2 — CID 71251659
butyl 2-thiophen-2-ylthieno[2,3-c]pyridine-5-carboxylate (PubChem CID 71251659) has the molecular formula C16H15NO2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is butyl 2-thiophen-2-ylthieno[2,3-c]pyridine-5-carboxylate.
| Compound Name | butyl 2-thiophen-2-ylthieno[2,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 71251659 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | butyl 2-thiophen-2-ylthieno[2,3-c]pyridine-5-carboxylate |
| SMILES | CCCCOC(=O)c1cc2cc(-c3cccs3)sc2cn1 |
| InChI | InChI=1S/C16H15NO2S2/c1-2-3-6-19-16(18)12-8-11-9-14(13-5-4-7-20-13)21-15(11)10-17-12/h4-5,7-10H,2-3,6H2,1H3 |
| InChIKey | VQCPJHVIHMISBI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|