About butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate
butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate (PubChem CID 110582850) has the molecular formula C19H17NO5S
and a molecular weight of 371.41 g/mol. Its IUPAC name is butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate.
Molecular Properties
| Compound Name | butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate |
| PubChem CID | 110582850 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate |
| SMILES | CCCCOC(=O)c1cccc(N2C(=O)C(O)=C(c3cccs3)C2=O)c1 |
| InChI | InChI=1S/C19H17NO5S/c1-2-3-9-25-19(24)12-6-4-7-13(11-12)20-17(22)15(16(21)18(20)23)14-8-5-10-26-14/h4-8,10-11,21H,2-3,9H2,1H3 |
| InChIKey | UYOPDRWLGWGNAC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate?
The IUPAC name of butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate (CID 110582850) is butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate.
What is the SMILES notation for butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate?
The canonical SMILES for butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate is CCCCOC(=O)c1cccc(N2C(=O)C(O)=C(c3cccs3)C2=O)c1.
What is the InChIKey of butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate?
The InChIKey is UYOPDRWLGWGNAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5S/c1-2-3-9-25-19(24)12-6-4-7-13(11-12)20-17(22)15(16(21)18(20)23)14-8-5-10-26-14/h4-8,10-11,21H,2-3,9H2,1H3.
What are the key properties of butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate?
butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate has a molecular weight of 371.41 g/mol, XLogP of 3.55, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-(3-hydroxy-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate is sourced from PubChem (CID 110582850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).