C18H17NO3S — CID 110582828
1-(4-tert-butylphenyl)-3-hydroxy-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110582828) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-hydroxy-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(4-tert-butylphenyl)-3-hydroxy-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582828 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-hydroxy-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CC(C)(C)c1ccc(N2C(=O)C(O)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C18H17NO3S/c1-18(2,3)11-6-8-12(9-7-11)19-16(21)14(15(20)17(19)22)13-5-4-10-23-13/h4-10,20H,1-3H3 |
| InChIKey | WIHHBNMXMHWYIA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|