C15H10INO3S — CID 110582863
3-hydroxy-1-(4-iodo-2-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110582863) has the molecular formula C15H10INO3S and a molecular weight of 411.22 g/mol. Its IUPAC name is 3-hydroxy-1-(4-iodo-2-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-hydroxy-1-(4-iodo-2-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582863 |
| Molecular Formula | C15H10INO3S |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.94 |
| IUPAC Name | 3-hydroxy-1-(4-iodo-2-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1cc(I)ccc1N1C(=O)C(O)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C15H10INO3S/c1-8-7-9(16)4-5-10(8)17-14(19)12(13(18)15(17)20)11-3-2-6-21-11/h2-7,18H,1H3 |
| InChIKey | MSAOQHIAZLXORO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|