C14H7ClFNO2S — CID 110583072
3-chloro-1-(4-fluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110583072) has the molecular formula C14H7ClFNO2S and a molecular weight of 307.73 g/mol. Its IUPAC name is 3-chloro-1-(4-fluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(4-fluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583072 |
| Molecular Formula | C14H7ClFNO2S |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 3-chloro-1-(4-fluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(c2cccs2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H7ClFNO2S/c15-12-11(10-2-1-7-20-10)13(18)17(14(12)19)9-5-3-8(16)4-6-9/h1-7H |
| InChIKey | JINVNFYCVITIRU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|