C18H16ClNO3S — CID 110583101
3-chloro-1-[4-(2-methylpropoxy)phenyl]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110583101) has the molecular formula C18H16ClNO3S and a molecular weight of 361.85 g/mol. Its IUPAC name is 3-chloro-1-[4-(2-methylpropoxy)phenyl]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-chloro-1-[4-(2-methylpropoxy)phenyl]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583101 |
| Molecular Formula | C18H16ClNO3S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 3-chloro-1-[4-(2-methylpropoxy)phenyl]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CC(C)COc1ccc(N2C(=O)C(Cl)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C18H16ClNO3S/c1-11(2)10-23-13-7-5-12(6-8-13)20-17(21)15(16(19)18(20)22)14-4-3-9-24-14/h3-9,11H,10H2,1-2H3 |
| InChIKey | ZZECLZFSHFFWBE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|