C17H14ClNO4S — CID 110583041
3-chloro-1-[2-(4-methoxyphenoxy)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110583041) has the molecular formula C17H14ClNO4S and a molecular weight of 363.82 g/mol. Its IUPAC name is 3-chloro-1-[2-(4-methoxyphenoxy)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-chloro-1-[2-(4-methoxyphenoxy)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583041 |
| Molecular Formula | C17H14ClNO4S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 3-chloro-1-[2-(4-methoxyphenoxy)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(OCCN2C(=O)C(Cl)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C17H14ClNO4S/c1-22-11-4-6-12(7-5-11)23-9-8-19-16(20)14(15(18)17(19)21)13-3-2-10-24-13/h2-7,10H,8-9H2,1H3 |
| InChIKey | CGLKLYYRXUPNCC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|