C19H16ClNO4S — CID 110583118
butyl 3-(3-chloro-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate (PubChem CID 110583118) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is butyl 3-(3-chloro-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate.
| Compound Name | butyl 3-(3-chloro-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 110583118 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | butyl 3-(3-chloro-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl)benzoate |
| SMILES | CCCCOC(=O)c1cccc(N2C(=O)C(Cl)=C(c3cccs3)C2=O)c1 |
| InChI | InChI=1S/C19H16ClNO4S/c1-2-3-9-25-19(24)12-6-4-7-13(11-12)21-17(22)15(16(20)18(21)23)14-8-5-10-26-14/h4-8,10-11H,2-3,9H2,1H3 |
| InChIKey | RBJYORQFEFMXAW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|