C25H22N2O4S — CID 110554464
propyl 4-[3-(N-methylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzoate (PubChem CID 110554464) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is propyl 4-[3-(N-methylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzoate.
| Compound Name | propyl 4-[3-(N-methylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 110554464 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | propyl 4-[3-(N-methylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzoate |
| SMILES | CCCOC(=O)c1ccc(N2C(=O)C(c3cccs3)=C(N(C)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H22N2O4S/c1-3-15-31-25(30)17-11-13-19(14-12-17)27-23(28)21(20-10-7-16-32-20)22(24(27)29)26(2)18-8-5-4-6-9-18/h4-14,16H,3,15H2,1-2H3 |
| InChIKey | MHSQTZOIGVQCJD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|