C27H23FN2O4 — CID 110545109
propyl 4-[3-(4-fluorophenyl)-4-(N-methylanilino)-2,5-dioxopyrrol-1-yl]benzoate (PubChem CID 110545109) has the molecular formula C27H23FN2O4 and a molecular weight of 458.49 g/mol. Its IUPAC name is propyl 4-[3-(4-fluorophenyl)-4-(N-methylanilino)-2,5-dioxopyrrol-1-yl]benzoate.
| Compound Name | propyl 4-[3-(4-fluorophenyl)-4-(N-methylanilino)-2,5-dioxopyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 110545109 |
| Molecular Formula | C27H23FN2O4 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | propyl 4-[3-(4-fluorophenyl)-4-(N-methylanilino)-2,5-dioxopyrrol-1-yl]benzoate |
| SMILES | CCCOC(=O)c1ccc(N2C(=O)C(c3ccc(F)cc3)=C(N(C)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H23FN2O4/c1-3-17-34-27(33)19-11-15-22(16-12-19)30-25(31)23(18-9-13-20(28)14-10-18)24(26(30)32)29(2)21-7-5-4-6-8-21/h4-16H,3,17H2,1-2H3 |
| InChIKey | JYJZHXDLWRNFKV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|