C23H24N2O6 — CID 110562148
2-methoxyethyl 4-[3-[2-hydroxyethyl(methyl)amino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzoate (PubChem CID 110562148) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-methoxyethyl 4-[3-[2-hydroxyethyl(methyl)amino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzoate.
| Compound Name | 2-methoxyethyl 4-[3-[2-hydroxyethyl(methyl)amino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 110562148 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-methoxyethyl 4-[3-[2-hydroxyethyl(methyl)amino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzoate |
| SMILES | COCCOC(=O)c1ccc(N2C(=O)C(c3ccccc3)=C(N(C)CCO)C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O6/c1-24(12-13-26)20-19(16-6-4-3-5-7-16)21(27)25(22(20)28)18-10-8-17(9-11-18)23(29)31-15-14-30-2/h3-11,26H,12-15H2,1-2H3 |
| InChIKey | QSRXNMSULDQRAL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|