C24H26N2O5 — CID 110561864
butyl 3-[3-[2-hydroxyethyl(methyl)amino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzoate (PubChem CID 110561864) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is butyl 3-[3-[2-hydroxyethyl(methyl)amino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzoate.
| Compound Name | butyl 3-[3-[2-hydroxyethyl(methyl)amino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 110561864 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | butyl 3-[3-[2-hydroxyethyl(methyl)amino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1cccc(N2C(=O)C(c3ccccc3)=C(N(C)CCO)C2=O)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-3-4-15-31-24(30)18-11-8-12-19(16-18)26-22(28)20(17-9-6-5-7-10-17)21(23(26)29)25(2)13-14-27/h5-12,16,27H,3-4,13-15H2,1-2H3 |
| InChIKey | VJRNFRVCZTYFIQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|