C23H23NO4S — CID 110561867
butyl 3-(3-ethylsulfanyl-2,5-dioxo-4-phenylpyrrol-1-yl)benzoate (PubChem CID 110561867) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is butyl 3-(3-ethylsulfanyl-2,5-dioxo-4-phenylpyrrol-1-yl)benzoate.
| Compound Name | butyl 3-(3-ethylsulfanyl-2,5-dioxo-4-phenylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 110561867 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | butyl 3-(3-ethylsulfanyl-2,5-dioxo-4-phenylpyrrol-1-yl)benzoate |
| SMILES | CCCCOC(=O)c1cccc(N2C(=O)C(SCC)=C(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C23H23NO4S/c1-3-5-14-28-23(27)17-12-9-13-18(15-17)24-21(25)19(16-10-7-6-8-11-16)20(22(24)26)29-4-2/h6-13,15H,3-5,14H2,1-2H3 |
| InChIKey | SDFFXBXNLIFPDC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|