C25H20FN3O3 — CID 110545385
N-[4-[3-(4-fluorophenyl)-4-(N-methylanilino)-2,5-dioxopyrrol-1-yl]phenyl]acetamide (PubChem CID 110545385) has the molecular formula C25H20FN3O3 and a molecular weight of 429.45 g/mol. Its IUPAC name is N-[4-[3-(4-fluorophenyl)-4-(N-methylanilino)-2,5-dioxopyrrol-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-(4-fluorophenyl)-4-(N-methylanilino)-2,5-dioxopyrrol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110545385 |
| Molecular Formula | C25H20FN3O3 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[4-[3-(4-fluorophenyl)-4-(N-methylanilino)-2,5-dioxopyrrol-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C(c3ccc(F)cc3)=C(N(C)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H20FN3O3/c1-16(30)27-19-12-14-21(15-13-19)29-24(31)22(17-8-10-18(26)11-9-17)23(25(29)32)28(2)20-6-4-3-5-7-20/h3-15H,1-2H3,(H,27,30) |
| InChIKey | DJZWXZWMFPQKHP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|