C20H17Cl2NO4 — CID 1100338
3-methylbutyl 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 1100338) has the molecular formula C20H17Cl2NO4 and a molecular weight of 406.27 g/mol. Its IUPAC name is 3-methylbutyl 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | 3-methylbutyl 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 1100338 |
| Molecular Formula | C20H17Cl2NO4 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 3-methylbutyl 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | CC(C)CCOC(=O)c1cccc(N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)c1 |
| InChI | InChI=1S/C20H17Cl2NO4/c1-11(2)6-7-27-20(26)12-4-3-5-13(8-12)23-18(24)14-9-16(21)17(22)10-15(14)19(23)25/h3-5,8-11H,6-7H2,1-2H3 |
| InChIKey | GPUBNNPBHVIFCZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|