C16H24O4 — CID 142336643
3-(3-methylbutoxycarbonyl)benzoic acid;propane (PubChem CID 142336643) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-(3-methylbutoxycarbonyl)benzoic acid;propane.
| Compound Name | 3-(3-methylbutoxycarbonyl)benzoic acid;propane |
|---|---|
| PubChem CID | 142336643 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3-(3-methylbutoxycarbonyl)benzoic acid;propane |
| SMILES | CC(C)CCOC(=O)c1cccc(C(=O)O)c1.CCC |
| InChI | InChI=1S/C13H16O4.C3H8/c1-9(2)6-7-17-13(16)11-5-3-4-10(8-11)12(14)15;1-3-2/h3-5,8-9H,6-7H2,1-2H3,(H,14,15);3H2,1-2H3 |
| InChIKey | XAODIVVNMHXWHE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |