C14H16O6 — CID 174925736
4-(3-methylbutoxycarbonyl)benzene-1,3-dicarboxylic acid (PubChem CID 174925736) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-(3-methylbutoxycarbonyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-(3-methylbutoxycarbonyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174925736 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-(3-methylbutoxycarbonyl)benzene-1,3-dicarboxylic acid |
| SMILES | CC(C)CCOC(=O)c1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C14H16O6/c1-8(2)5-6-20-14(19)10-4-3-9(12(15)16)7-11(10)13(17)18/h3-4,7-8H,5-6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | YQKUQUHBKPTKMG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |