C14H16O9 — CID 139774965
4-(2,2,2-trimethoxyethoxycarbonyl)benzene-1,3-dicarboxylic acid (PubChem CID 139774965) has the molecular formula C14H16O9 and a molecular weight of 328.27 g/mol. Its IUPAC name is 4-(2,2,2-trimethoxyethoxycarbonyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-(2,2,2-trimethoxyethoxycarbonyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 139774965 |
| Molecular Formula | C14H16O9 |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 4-(2,2,2-trimethoxyethoxycarbonyl)benzene-1,3-dicarboxylic acid |
| SMILES | COC(COC(=O)c1ccc(C(=O)O)cc1C(=O)O)(OC)OC |
| InChI | InChI=1S/C14H16O9/c1-20-14(21-2,22-3)7-23-13(19)9-5-4-8(11(15)16)6-10(9)12(17)18/h4-6H,7H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | ILPZGOJLKARSTN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|