ethane;4-methoxycarbonylphthalic acid

C14H20O6 — CID 143938031

IUPACethane;4-methoxycarbonylphthalic acid
SMILESCC.CC.COC(=O)c1ccc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C10H8O6.2C2H6/c1-16-10(15)5-2-3-6(8(11)12)7(4-5)9(13)14;2*1-2/h2-4H,1H3,(H,11,12)(H,13,14);2*1-2H3
InChIKeySAGWRDUHUZZPJP-UHFFFAOYSA-N
MW284.31 g/mol
LogP2.92
Rot. Bonds3

About ethane;4-methoxycarbonylphthalic acid

ethane;4-methoxycarbonylphthalic acid (PubChem CID 143938031) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethane;4-methoxycarbonylphthalic acid.

Molecular Properties

Compound Nameethane;4-methoxycarbonylphthalic acid
PubChem CID143938031
Molecular FormulaC14H20O6
Molecular Weight284.31 g/mol
Exact Mass284.13
IUPAC Nameethane;4-methoxycarbonylphthalic acid
SMILESCC.CC.COC(=O)c1ccc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C10H8O6.2C2H6/c1-16-10(15)5-2-3-6(8(11)12)7(4-5)9(13)14;2*1-2/h2-4H,1H3,(H,11,12)(H,13,14);2*1-2H3
InChIKeySAGWRDUHUZZPJP-UHFFFAOYSA-N
XLogP2.92
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.31
LogP ≤ 52.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze ethane;4-methoxycarbonylphthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;4-methoxycarbonylphthalic acid?
The IUPAC name of ethane;4-methoxycarbonylphthalic acid (CID 143938031) is ethane;4-methoxycarbonylphthalic acid.
What is the SMILES notation for ethane;4-methoxycarbonylphthalic acid?
The canonical SMILES for ethane;4-methoxycarbonylphthalic acid is CC.CC.COC(=O)c1ccc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of ethane;4-methoxycarbonylphthalic acid?
The InChIKey is SAGWRDUHUZZPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O6.2C2H6/c1-16-10(15)5-2-3-6(8(11)12)7(4-5)9(13)14;2*1-2/h2-4H,1H3,(H,11,12)(H,13,14);2*1-2H3.
What are the key properties of ethane;4-methoxycarbonylphthalic acid?
ethane;4-methoxycarbonylphthalic acid has a molecular weight of 284.31 g/mol, XLogP of 2.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methoxycarbonylphthalic acid is sourced from PubChem (CID 143938031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).