C14H20O6 — CID 143938031
ethane;4-methoxycarbonylphthalic acid (PubChem CID 143938031) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethane;4-methoxycarbonylphthalic acid.
| Compound Name | ethane;4-methoxycarbonylphthalic acid |
|---|---|
| PubChem CID | 143938031 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethane;4-methoxycarbonylphthalic acid |
| SMILES | CC.CC.COC(=O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H8O6.2C2H6/c1-16-10(15)5-2-3-6(8(11)12)7(4-5)9(13)14;2*1-2/h2-4H,1H3,(H,11,12)(H,13,14);2*1-2H3 |
| InChIKey | SAGWRDUHUZZPJP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |