C34H30O12 — CID 163623583
4-[4-[4-(3,4-dicarboxybenzoyl)oxyphenyl]phenoxy]carbonylphthalic acid;ethane (PubChem CID 163623583) has the molecular formula C34H30O12 and a molecular weight of 630.60 g/mol. Its IUPAC name is 4-[4-[4-(3,4-dicarboxybenzoyl)oxyphenyl]phenoxy]carbonylphthalic acid;ethane.
| Compound Name | 4-[4-[4-(3,4-dicarboxybenzoyl)oxyphenyl]phenoxy]carbonylphthalic acid;ethane |
|---|---|
| PubChem CID | 163623583 |
| Molecular Formula | C34H30O12 |
| Molecular Weight | 630.60 g/mol |
| Exact Mass | 630.17 |
| IUPAC Name | 4-[4-[4-(3,4-dicarboxybenzoyl)oxyphenyl]phenoxy]carbonylphthalic acid;ethane |
| SMILES | CC.CC.O=C(Oc1ccc(-c2ccc(OC(=O)c3ccc(C(=O)O)c(C(=O)O)c3)cc2)cc1)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C30H18O12.2C2H6/c31-25(32)21-11-5-17(13-23(21)27(35)36)29(39)41-19-7-1-15(2-8-19)16-3-9-20(10-4-16)42-30(40)18-6-12-22(26(33)34)24(14-18)28(37)38;2*1-2/h1-14H,(H,31,32)(H,33,34)(H,35,36)(H,37,38);2*1-2H3 |
| InChIKey | HQFBLJWTHAYZFJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 201.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|