C20H16Cl3NO3 — CID 110582598
3-chloro-1-(2,3-dichlorophenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110582598) has the molecular formula C20H16Cl3NO3 and a molecular weight of 424.71 g/mol. Its IUPAC name is 3-chloro-1-(2,3-dichlorophenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(2,3-dichlorophenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582598 |
| Molecular Formula | C20H16Cl3NO3 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 3-chloro-1-(2,3-dichlorophenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
| SMILES | CC(C)COc1ccc(C2=C(Cl)C(=O)N(c3cccc(Cl)c3Cl)C2=O)cc1 |
| InChI | InChI=1S/C20H16Cl3NO3/c1-11(2)10-27-13-8-6-12(7-9-13)16-18(23)20(26)24(19(16)25)15-5-3-4-14(21)17(15)22/h3-9,11H,10H2,1-2H3 |
| InChIKey | HGYZAEKEMPDRIM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|