C24H25NO6 — CID 110582457
butyl 4-[3-hydroxy-2,5-dioxo-4-(4-propoxyphenyl)pyrrol-1-yl]benzoate (PubChem CID 110582457) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is butyl 4-[3-hydroxy-2,5-dioxo-4-(4-propoxyphenyl)pyrrol-1-yl]benzoate.
| Compound Name | butyl 4-[3-hydroxy-2,5-dioxo-4-(4-propoxyphenyl)pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 110582457 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | butyl 4-[3-hydroxy-2,5-dioxo-4-(4-propoxyphenyl)pyrrol-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)C(O)=C(c3ccc(OCCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H25NO6/c1-3-5-15-31-24(29)17-6-10-18(11-7-17)25-22(27)20(21(26)23(25)28)16-8-12-19(13-9-16)30-14-4-2/h6-13,26H,3-5,14-15H2,1-2H3 |
| InChIKey | PHCAWICSSKVVMK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|