C23H23NO5 — CID 110582715
butyl 4-[3-(2,4-dimethylphenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]benzoate (PubChem CID 110582715) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is butyl 4-[3-(2,4-dimethylphenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]benzoate.
| Compound Name | butyl 4-[3-(2,4-dimethylphenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 110582715 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | butyl 4-[3-(2,4-dimethylphenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)C(O)=C(c3ccc(C)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-4-5-12-29-23(28)16-7-9-17(10-8-16)24-21(26)19(20(25)22(24)27)18-11-6-14(2)13-15(18)3/h6-11,13,25H,4-5,12H2,1-3H3 |
| InChIKey | MOEVYYJKGSVPCZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|