C12H8N2O3S — CID 141186453
4-(furan-3-yl)-7-hydroxythieno[3,2-c]pyridine-6-carboxamide (PubChem CID 141186453) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is 4-(furan-3-yl)-7-hydroxythieno[3,2-c]pyridine-6-carboxamide.
| Compound Name | 4-(furan-3-yl)-7-hydroxythieno[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 141186453 |
| Molecular Formula | C12H8N2O3S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-(furan-3-yl)-7-hydroxythieno[3,2-c]pyridine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2ccoc2)c2ccsc2c1O |
| InChI | InChI=1S/C12H8N2O3S/c13-12(16)9-10(15)11-7(2-4-18-11)8(14-9)6-1-3-17-5-6/h1-5,15H,(H2,13,16) |
| InChIKey | CEYNIADEMIFICX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |