About 3-(furan-3-yl)furan;nitric acid
3-(furan-3-yl)furan;nitric acid (PubChem CID 175941558) has the molecular formula C8H7NO5
and a molecular weight of 197.15 g/mol. Its IUPAC name is 3-(furan-3-yl)furan;nitric acid.
Molecular Properties
| Compound Name | 3-(furan-3-yl)furan;nitric acid |
| PubChem CID | 175941558 |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 3-(furan-3-yl)furan;nitric acid |
| SMILES | O=[N+]([O-])O.c1cc(-c2ccoc2)co1 |
| InChI | InChI=1S/C8H6O2.HNO3/c1-3-9-5-7(1)8-2-4-10-6-8;2-1(3)4/h1-6H;(H,2,3,4) |
| InChIKey | KBZYAVVJGYUIHM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(furan-3-yl)furan;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-3-yl)furan;nitric acid?
The IUPAC name of 3-(furan-3-yl)furan;nitric acid (CID 175941558) is 3-(furan-3-yl)furan;nitric acid.
What is the SMILES notation for 3-(furan-3-yl)furan;nitric acid?
The canonical SMILES for 3-(furan-3-yl)furan;nitric acid is O=[N+]([O-])O.c1cc(-c2ccoc2)co1.
What is the InChIKey of 3-(furan-3-yl)furan;nitric acid?
The InChIKey is KBZYAVVJGYUIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.HNO3/c1-3-9-5-7(1)8-2-4-10-6-8;2-1(3)4/h1-6H;(H,2,3,4).
What are the key properties of 3-(furan-3-yl)furan;nitric acid?
3-(furan-3-yl)furan;nitric acid has a molecular weight of 197.15 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-3-yl)furan;nitric acid is sourced from PubChem (CID 175941558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).