3-(furan-3-yl)furan;nitric acid

C8H7NO5 — CID 175941558

IUPAC3-(furan-3-yl)furan;nitric acid
SMILESO=[N+]([O-])O.c1cc(-c2ccoc2)co1
InChIInChI=1S/C8H6O2.HNO3/c1-3-9-5-7(1)8-2-4-10-6-8;2-1(3)4/h1-6H;(H,2,3,4)
InChIKeyKBZYAVVJGYUIHM-UHFFFAOYSA-N
MW197.15 g/mol
LogP2.19
Rot. Bonds1

About 3-(furan-3-yl)furan;nitric acid

3-(furan-3-yl)furan;nitric acid (PubChem CID 175941558) has the molecular formula C8H7NO5 and a molecular weight of 197.15 g/mol. Its IUPAC name is 3-(furan-3-yl)furan;nitric acid.

Molecular Properties

Compound Name3-(furan-3-yl)furan;nitric acid
PubChem CID175941558
Molecular FormulaC8H7NO5
Molecular Weight197.15 g/mol
Exact Mass197.03
IUPAC Name3-(furan-3-yl)furan;nitric acid
SMILESO=[N+]([O-])O.c1cc(-c2ccoc2)co1
InChIInChI=1S/C8H6O2.HNO3/c1-3-9-5-7(1)8-2-4-10-6-8;2-1(3)4/h1-6H;(H,2,3,4)
InChIKeyKBZYAVVJGYUIHM-UHFFFAOYSA-N
XLogP2.19
TPSA89.65 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.15
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-(furan-3-yl)furan;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(furan-3-yl)furan;nitric acid?
The IUPAC name of 3-(furan-3-yl)furan;nitric acid (CID 175941558) is 3-(furan-3-yl)furan;nitric acid.
What is the SMILES notation for 3-(furan-3-yl)furan;nitric acid?
The canonical SMILES for 3-(furan-3-yl)furan;nitric acid is O=[N+]([O-])O.c1cc(-c2ccoc2)co1.
What is the InChIKey of 3-(furan-3-yl)furan;nitric acid?
The InChIKey is KBZYAVVJGYUIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.HNO3/c1-3-9-5-7(1)8-2-4-10-6-8;2-1(3)4/h1-6H;(H,2,3,4).
What are the key properties of 3-(furan-3-yl)furan;nitric acid?
3-(furan-3-yl)furan;nitric acid has a molecular weight of 197.15 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-3-yl)furan;nitric acid is sourced from PubChem (CID 175941558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).