C13H15NO3S — CID 67233759
butyl 4-hydroxy-7-methylthieno[2,3-c]pyridine-5-carboxylate (PubChem CID 67233759) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is butyl 4-hydroxy-7-methylthieno[2,3-c]pyridine-5-carboxylate.
| Compound Name | butyl 4-hydroxy-7-methylthieno[2,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 67233759 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | butyl 4-hydroxy-7-methylthieno[2,3-c]pyridine-5-carboxylate |
| SMILES | CCCCOC(=O)c1nc(C)c2sccc2c1O |
| InChI | InChI=1S/C13H15NO3S/c1-3-4-6-17-13(16)10-11(15)9-5-7-18-12(9)8(2)14-10/h5,7,15H,3-4,6H2,1-2H3 |
| InChIKey | ZJWHHDGPGFAJDH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|