C15H21Cl3N2O2 — CID 91732266
nonyl 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 91732266) has the molecular formula C15H21Cl3N2O2 and a molecular weight of 367.70 g/mol. Its IUPAC name is nonyl 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | nonyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 91732266 |
| Molecular Formula | C15H21Cl3N2O2 |
| Molecular Weight | 367.70 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | nonyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | CCCCCCCCCOC(=O)c1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C15H21Cl3N2O2/c1-2-3-4-5-6-7-8-9-22-15(21)13-10(16)12(19)11(17)14(18)20-13/h2-9H2,1H3,(H2,19,20) |
| InChIKey | LRVNQKKBMWROFC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|