C11H14Cl3N2O2+ — CID 6995369
pentyl 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate (PubChem CID 6995369) has the molecular formula C11H14Cl3N2O2+ and a molecular weight of 312.60 g/mol. Its IUPAC name is pentyl 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate.
| Compound Name | pentyl 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 6995369 |
| Molecular Formula | C11H14Cl3N2O2+ |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | pentyl 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
| SMILES | CCCCCOC(=O)c1[nH+]c(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C11H13Cl3N2O2/c1-2-3-4-5-18-11(17)9-6(12)8(15)7(13)10(14)16-9/h2-5H2,1H3,(H2,15,16)/p+1 |
| InChIKey | KQYCKQCWZBLLBP-UHFFFAOYSA-O |
| XLogP | 3.39 |
| TPSA | 66.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|