C13H15Cl3N3O3+ — CID 7633894
[2-(cyclopentylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate (PubChem CID 7633894) has the molecular formula C13H15Cl3N3O3+ and a molecular weight of 367.64 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7633894 |
| Molecular Formula | C13H15Cl3N3O3+ |
| Molecular Weight | 367.64 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
| SMILES | Nc1c(Cl)c(Cl)[nH+]c(C(=O)OCC(=O)NC2CCCC2)c1Cl |
| InChI | InChI=1S/C13H14Cl3N3O3/c14-8-10(17)9(15)12(16)19-11(8)13(21)22-5-7(20)18-6-3-1-2-4-6/h6H,1-5H2,(H2,17,19)(H,18,20)/p+1 |
| InChIKey | PYYMNEFUSHLPIL-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.64 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|