C16H21Cl3N3O3+ — CID 11909744
[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate (PubChem CID 11909744) has the molecular formula C16H21Cl3N3O3+ and a molecular weight of 409.72 g/mol. Its IUPAC name is [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate.
| Compound Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 11909744 |
| Molecular Formula | C16H21Cl3N3O3+ |
| Molecular Weight | 409.72 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
| SMILES | CC1CCC[C@@H](NC(=O)COC(=O)c2[nH+]c(Cl)c(Cl)c(N)c2Cl)[C@@H]1C |
| InChI | InChI=1S/C16H20Cl3N3O3/c1-7-4-3-5-9(8(7)2)21-10(23)6-25-16(24)14-11(17)13(20)12(18)15(19)22-14/h7-9H,3-6H2,1-2H3,(H2,20,22)(H,21,23)/p+1/t7?,8-,9-/m1/s1 |
| InChIKey | MXXWZBOLDYPXHN-CFCGPWAMSA-O |
| XLogP | 3.14 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|