C22H22O6 — CID 132553399
butyl 3,6-dihydroxy-2-(2-hydroxy-7-methoxynaphthalen-1-yl)benzoate (PubChem CID 132553399) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is butyl 3,6-dihydroxy-2-(2-hydroxy-7-methoxynaphthalen-1-yl)benzoate.
| Compound Name | butyl 3,6-dihydroxy-2-(2-hydroxy-7-methoxynaphthalen-1-yl)benzoate |
|---|---|
| PubChem CID | 132553399 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | butyl 3,6-dihydroxy-2-(2-hydroxy-7-methoxynaphthalen-1-yl)benzoate |
| SMILES | CCCCOC(=O)c1c(O)ccc(O)c1-c1c(O)ccc2ccc(OC)cc12 |
| InChI | InChI=1S/C22H22O6/c1-3-4-11-28-22(26)21-18(25)10-9-17(24)20(21)19-15-12-14(27-2)7-5-13(15)6-8-16(19)23/h5-10,12,23-25H,3-4,11H2,1-2H3 |
| InChIKey | MAVPDABCJKFYRG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|