C23H26O9 — CID 11733003
tetraethyl 6-methoxynaphthalene-1,2,3,4-tetracarboxylate (PubChem CID 11733003) has the molecular formula C23H26O9 and a molecular weight of 446.45 g/mol. Its IUPAC name is tetraethyl 6-methoxynaphthalene-1,2,3,4-tetracarboxylate.
| Compound Name | tetraethyl 6-methoxynaphthalene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 11733003 |
| Molecular Formula | C23H26O9 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | tetraethyl 6-methoxynaphthalene-1,2,3,4-tetracarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c(C(=O)OCC)c2cc(OC)ccc2c1C(=O)OCC |
| InChI | InChI=1S/C23H26O9/c1-6-29-20(24)16-14-11-10-13(28-5)12-15(14)17(21(25)30-7-2)19(23(27)32-9-4)18(16)22(26)31-8-3/h10-12H,6-9H2,1-5H3 |
| InChIKey | CREFFISJHPYNBI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|