C16H21NO4 — CID 99990777
ethyl 5-methoxy-1-(2-methoxyethyl)-2-methylindole-3-carboxylate (PubChem CID 99990777) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 5-methoxy-1-(2-methoxyethyl)-2-methylindole-3-carboxylate.
| Compound Name | ethyl 5-methoxy-1-(2-methoxyethyl)-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 99990777 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl 5-methoxy-1-(2-methoxyethyl)-2-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(CCOC)c2ccc(OC)cc12 |
| InChI | InChI=1S/C16H21NO4/c1-5-21-16(18)15-11(2)17(8-9-19-3)14-7-6-12(20-4)10-13(14)15/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | RIMWMXJIQUJRKX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |