C27H27NO5 — CID 2076757
ethyl 1-(4-methoxyphenyl)-2-methyl-5-(2-phenoxyethoxy)indole-3-carboxylate (PubChem CID 2076757) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is ethyl 1-(4-methoxyphenyl)-2-methyl-5-(2-phenoxyethoxy)indole-3-carboxylate.
| Compound Name | ethyl 1-(4-methoxyphenyl)-2-methyl-5-(2-phenoxyethoxy)indole-3-carboxylate |
|---|---|
| PubChem CID | 2076757 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | ethyl 1-(4-methoxyphenyl)-2-methyl-5-(2-phenoxyethoxy)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccc(OC)cc2)c2ccc(OCCOc3ccccc3)cc12 |
| InChI | InChI=1S/C27H27NO5/c1-4-31-27(29)26-19(2)28(20-10-12-21(30-3)13-11-20)25-15-14-23(18-24(25)26)33-17-16-32-22-8-6-5-7-9-22/h5-15,18H,4,16-17H2,1-3H3 |
| InChIKey | ZLXJBXSRSWJEGC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|