C20H21NO2 — CID 46891660
1-(2-methyl-1-phenyl-5-propoxyindol-3-yl)ethanone (PubChem CID 46891660) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(2-methyl-1-phenyl-5-propoxyindol-3-yl)ethanone.
| Compound Name | 1-(2-methyl-1-phenyl-5-propoxyindol-3-yl)ethanone |
|---|---|
| PubChem CID | 46891660 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-(2-methyl-1-phenyl-5-propoxyindol-3-yl)ethanone |
| SMILES | CCCOc1ccc2c(c1)c(C(C)=O)c(C)n2-c1ccccc1 |
| InChI | InChI=1S/C20H21NO2/c1-4-12-23-17-10-11-19-18(13-17)20(15(3)22)14(2)21(19)16-8-6-5-7-9-16/h5-11,13H,4,12H2,1-3H3 |
| InChIKey | ONGORAHLJZTEAA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |