C23H28N2O3 — CID 23768342
ethyl 5-[2-(dimethylamino)ethoxy]-2-methyl-1-(4-methylphenyl)indole-3-carboxylate (PubChem CID 23768342) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is ethyl 5-[2-(dimethylamino)ethoxy]-2-methyl-1-(4-methylphenyl)indole-3-carboxylate.
| Compound Name | ethyl 5-[2-(dimethylamino)ethoxy]-2-methyl-1-(4-methylphenyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 23768342 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | ethyl 5-[2-(dimethylamino)ethoxy]-2-methyl-1-(4-methylphenyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccc(C)cc2)c2ccc(OCCN(C)C)cc12 |
| InChI | InChI=1S/C23H28N2O3/c1-6-27-23(26)22-17(3)25(18-9-7-16(2)8-10-18)21-12-11-19(15-20(21)22)28-14-13-24(4)5/h7-12,15H,6,13-14H2,1-5H3 |
| InChIKey | HGPRKRPXKSWIOB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |