C27H37N3O3 — CID 23935259
ethyl 1-[4-(diethylamino)phenyl]-5-[1-(dimethylamino)propan-2-yloxy]-2-methylindole-3-carboxylate (PubChem CID 23935259) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is ethyl 1-[4-(diethylamino)phenyl]-5-[1-(dimethylamino)propan-2-yloxy]-2-methylindole-3-carboxylate.
| Compound Name | ethyl 1-[4-(diethylamino)phenyl]-5-[1-(dimethylamino)propan-2-yloxy]-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 23935259 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | ethyl 1-[4-(diethylamino)phenyl]-5-[1-(dimethylamino)propan-2-yloxy]-2-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccc(N(CC)CC)cc2)c2ccc(OC(C)CN(C)C)cc12 |
| InChI | InChI=1S/C27H37N3O3/c1-8-29(9-2)21-11-13-22(14-12-21)30-20(5)26(27(31)32-10-3)24-17-23(15-16-25(24)30)33-19(4)18-28(6)7/h11-17,19H,8-10,18H2,1-7H3 |
| InChIKey | KMOOZHFFUDUXGD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|