C25H29NO6 — CID 19238131
ethyl 1-(4-ethoxyphenyl)-5-(1-methoxy-1-oxobutan-2-yl)oxy-2-methylindole-3-carboxylate (PubChem CID 19238131) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is ethyl 1-(4-ethoxyphenyl)-5-(1-methoxy-1-oxobutan-2-yl)oxy-2-methylindole-3-carboxylate.
| Compound Name | ethyl 1-(4-ethoxyphenyl)-5-(1-methoxy-1-oxobutan-2-yl)oxy-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 19238131 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | ethyl 1-(4-ethoxyphenyl)-5-(1-methoxy-1-oxobutan-2-yl)oxy-2-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccc(OCC)cc2)c2ccc(OC(CC)C(=O)OC)cc12 |
| InChI | InChI=1S/C25H29NO6/c1-6-22(24(27)29-5)32-19-13-14-21-20(15-19)23(25(28)31-8-3)16(4)26(21)17-9-11-18(12-10-17)30-7-2/h9-15,22H,6-8H2,1-5H3 |
| InChIKey | UPLZEESKVPGVHR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |