C21H23NO5 — CID 17138681
2-methoxyethyl 1-(4-ethoxyphenyl)-5-hydroxy-2-methylindole-3-carboxylate (PubChem CID 17138681) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-methoxyethyl 1-(4-ethoxyphenyl)-5-hydroxy-2-methylindole-3-carboxylate.
| Compound Name | 2-methoxyethyl 1-(4-ethoxyphenyl)-5-hydroxy-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 17138681 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-methoxyethyl 1-(4-ethoxyphenyl)-5-hydroxy-2-methylindole-3-carboxylate |
| SMILES | CCOc1ccc(-n2c(C)c(C(=O)OCCOC)c3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-4-26-17-8-5-15(6-9-17)22-14(2)20(21(24)27-12-11-25-3)18-13-16(23)7-10-19(18)22/h5-10,13,23H,4,11-12H2,1-3H3 |
| InChIKey | DKZJQGHTCYXZNY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|