C20H19NO6 — CID 67021214
2-(2-ethoxy-2-oxoethyl)-5-hydroxy-1-(4-methoxyphenyl)indole-3-carboxylic acid (PubChem CID 67021214) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethyl)-5-hydroxy-1-(4-methoxyphenyl)indole-3-carboxylic acid.
| Compound Name | 2-(2-ethoxy-2-oxoethyl)-5-hydroxy-1-(4-methoxyphenyl)indole-3-carboxylic acid |
|---|---|
| PubChem CID | 67021214 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(2-ethoxy-2-oxoethyl)-5-hydroxy-1-(4-methoxyphenyl)indole-3-carboxylic acid |
| SMILES | CCOC(=O)Cc1c(C(=O)O)c2cc(O)ccc2n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H19NO6/c1-3-27-18(23)11-17-19(20(24)25)15-10-13(22)6-9-16(15)21(17)12-4-7-14(26-2)8-5-12/h4-10,22H,3,11H2,1-2H3,(H,24,25) |
| InChIKey | MSCJUTRNVVQVBU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |