C32H33ClN2O5 — CID 66657710
ethyl 5-(4-chlorophenoxy)-2-(2-ethoxy-2-oxoethyl)-1-(4-piperidin-1-ylphenyl)indole-3-carboxylate (PubChem CID 66657710) has the molecular formula C32H33ClN2O5 and a molecular weight of 561.08 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenoxy)-2-(2-ethoxy-2-oxoethyl)-1-(4-piperidin-1-ylphenyl)indole-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenoxy)-2-(2-ethoxy-2-oxoethyl)-1-(4-piperidin-1-ylphenyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 66657710 |
| Molecular Formula | C32H33ClN2O5 |
| Molecular Weight | 561.08 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | ethyl 5-(4-chlorophenoxy)-2-(2-ethoxy-2-oxoethyl)-1-(4-piperidin-1-ylphenyl)indole-3-carboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OCC)c2cc(Oc3ccc(Cl)cc3)ccc2n1-c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C32H33ClN2O5/c1-3-38-30(36)21-29-31(32(37)39-4-2)27-20-26(40-25-14-8-22(33)9-15-25)16-17-28(27)35(29)24-12-10-23(11-13-24)34-18-6-5-7-19-34/h8-17,20H,3-7,18-19,21H2,1-2H3 |
| InChIKey | XDEXJRISLQLRBW-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.08 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|