C24H26BrClN2O3 — CID 10029188
ethyl 6-bromo-1-(4-chlorophenyl)-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)indole-3-carboxylate (PubChem CID 10029188) has the molecular formula C24H26BrClN2O3 and a molecular weight of 505.84 g/mol. Its IUPAC name is ethyl 6-bromo-1-(4-chlorophenyl)-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-1-(4-chlorophenyl)-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 10029188 |
| Molecular Formula | C24H26BrClN2O3 |
| Molecular Weight | 505.84 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | ethyl 6-bromo-1-(4-chlorophenyl)-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccc(Cl)cc2)c2cc(Br)c(O)c(CN3CCCCC3)c12 |
| InChI | InChI=1S/C24H26BrClN2O3/c1-3-31-24(30)21-15(2)28(17-9-7-16(26)8-10-17)20-13-19(25)23(29)18(22(20)21)14-27-11-5-4-6-12-27/h7-10,13,29H,3-6,11-12,14H2,1-2H3 |
| InChIKey | CDSLVTQMBYWBDA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.84 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|