C25H26BrClN2O3S — CID 87321728
ethyl 6-bromo-2-(3-chlorobenzenecarbothioyl)-1-ethyl-5-hydroxy-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate (PubChem CID 87321728) has the molecular formula C25H26BrClN2O3S and a molecular weight of 549.92 g/mol. Its IUPAC name is ethyl 6-bromo-2-(3-chlorobenzenecarbothioyl)-1-ethyl-5-hydroxy-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-2-(3-chlorobenzenecarbothioyl)-1-ethyl-5-hydroxy-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 87321728 |
| Molecular Formula | C25H26BrClN2O3S |
| Molecular Weight | 549.92 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | ethyl 6-bromo-2-(3-chlorobenzenecarbothioyl)-1-ethyl-5-hydroxy-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(=S)c2cccc(Cl)c2)n(CC)c2cc(Br)c(O)c(CN3CCCC3)c12 |
| InChI | InChI=1S/C25H26BrClN2O3S/c1-3-29-19-13-18(26)23(30)17(14-28-10-5-6-11-28)20(19)21(25(31)32-4-2)22(29)24(33)15-8-7-9-16(27)12-15/h7-9,12-13,30H,3-6,10-11,14H2,1-2H3 |
| InChIKey | RXRBBFGKZZHLKU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.92 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|