C25H27BrN2O5S — CID 87322423
ethyl 6-bromo-5-hydroxy-1-methyl-2-[(2-methylphenyl)-sulfinylmethyl]-4-(morpholin-4-ylmethyl)indole-3-carboxylate (PubChem CID 87322423) has the molecular formula C25H27BrN2O5S and a molecular weight of 547.47 g/mol. Its IUPAC name is ethyl 6-bromo-5-hydroxy-1-methyl-2-[(2-methylphenyl)-sulfinylmethyl]-4-(morpholin-4-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-hydroxy-1-methyl-2-[(2-methylphenyl)-sulfinylmethyl]-4-(morpholin-4-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 87322423 |
| Molecular Formula | C25H27BrN2O5S |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | ethyl 6-bromo-5-hydroxy-1-methyl-2-[(2-methylphenyl)-sulfinylmethyl]-4-(morpholin-4-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(=S=O)c2ccccc2C)n(C)c2cc(Br)c(O)c(CN3CCOCC3)c12 |
| InChI | InChI=1S/C25H27BrN2O5S/c1-4-33-25(30)21-20-17(14-28-9-11-32-12-10-28)23(29)18(26)13-19(20)27(3)22(21)24(34-31)16-8-6-5-7-15(16)2/h5-8,13,29H,4,9-12,14H2,1-3H3 |
| InChIKey | OSOSKKXMDLDORO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|