C26H31BrN2O4S — CID 59820783
ethyl 6-bromo-5-hydroxy-1-methyl-4-(morpholin-4-ylmethyl)-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate (PubChem CID 59820783) has the molecular formula C26H31BrN2O4S and a molecular weight of 547.52 g/mol. Its IUPAC name is ethyl 6-bromo-5-hydroxy-1-methyl-4-(morpholin-4-ylmethyl)-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-hydroxy-1-methyl-4-(morpholin-4-ylmethyl)-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 59820783 |
| Molecular Formula | C26H31BrN2O4S |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | ethyl 6-bromo-5-hydroxy-1-methyl-4-(morpholin-4-ylmethyl)-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CSCCc2ccccc2)n(C)c2cc(Br)c(O)c(CN3CCOCC3)c12 |
| InChI | InChI=1S/C26H31BrN2O4S/c1-3-33-26(31)24-22(17-34-14-9-18-7-5-4-6-8-18)28(2)21-15-20(27)25(30)19(23(21)24)16-29-10-12-32-13-11-29/h4-8,15,30H,3,9-14,16-17H2,1-2H3 |
| InChIKey | JPLXDLRVIMZPIC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|